C19H22ClN3O4S2 — CID 4082690
N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetamide (PubChem CID 4082690) has the molecular formula C19H22ClN3O4S2 and a molecular weight of 455.99 g/mol. Its IUPAC name is N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetamide.
| Compound Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetamide |
|---|---|
| PubChem CID | 4082690 |
| Molecular Formula | C19H22ClN3O4S2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-(6-chloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetamide |
| SMILES | C=CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCCC2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H22ClN3O4S2/c1-2-8-23-15-7-6-14(20)11-16(15)28-19(23)21-17(24)12-29(26,27)13-18(25)22-9-4-3-5-10-22/h2,6-7,11H,1,3-5,8-10,12-13H2/b21-19- |
| InChIKey | OKXIBIMUZAMCMM-VZCXRCSSSA-N |
| XLogP | 2.40 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|