C20H17FN4O2S — CID 43938262
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]quinoxaline-2-carboxamide (PubChem CID 43938262) has the molecular formula C20H17FN4O2S and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]quinoxaline-2-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 43938262 |
| Molecular Formula | C20H17FN4O2S |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]quinoxaline-2-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cnc3ccccc3n2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C20H17FN4O2S/c1-2-27-10-9-25-17-8-7-13(21)11-18(17)28-20(25)24-19(26)16-12-22-14-5-3-4-6-15(14)23-16/h3-8,11-12H,2,9-10H2,1H3/b24-20- |
| InChIKey | BKAMYABMPKIWRT-GFMRDNFCSA-N |
| XLogP | 3.56 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|