C24H28FN3O4S2 — CID 5152089
N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 5152089) has the molecular formula C24H28FN3O4S2 and a molecular weight of 505.64 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 5152089 |
| Molecular Formula | C24H28FN3O4S2 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-fluoro-1,3-benzothiazol-2-ylidene]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C24H28FN3O4S2/c1-3-32-15-14-28-21-9-6-19(25)16-22(21)33-24(28)26-23(29)18-4-7-20(8-5-18)34(30,31)27-12-10-17(2)11-13-27/h4-9,16-17H,3,10-15H2,1-2H3/b26-24- |
| InChIKey | QCHBVAFFQZSLPR-LCUIJRPUSA-N |
| XLogP | 4.04 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|