C19H15FN2O2S — CID 43945110
N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methylphenoxy)acetamide (PubChem CID 43945110) has the molecular formula C19H15FN2O2S and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methylphenoxy)acetamide.
| Compound Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 43945110 |
| Molecular Formula | C19H15FN2O2S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-(3-methylphenoxy)acetamide |
| SMILES | C#CCn1/c(=N/C(=O)COc2cccc(C)c2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C19H15FN2O2S/c1-3-9-22-16-8-7-14(20)11-17(16)25-19(22)21-18(23)12-24-15-6-4-5-13(2)10-15/h1,4-8,10-11H,9,12H2,2H3/b21-19- |
| InChIKey | OEXSQRCDNIKWAH-VZCXRCSSSA-N |
| XLogP | 3.29 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|