C20H18N2O3S — CID 7152857
N-(4-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-phenoxyacetamide (PubChem CID 7152857) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(4-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-phenoxyacetamide.
| Compound Name | N-(4-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 7152857 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(4-ethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-phenoxyacetamide |
| SMILES | C#CCn1/c(=N/C(=O)COc2ccccc2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C20H18N2O3S/c1-3-13-22-19-16(24-4-2)11-8-12-17(19)26-20(22)21-18(23)14-25-15-9-6-5-7-10-15/h1,5-12H,4,13-14H2,2H3/b21-20- |
| InChIKey | CBDOCPNUSBRHJO-MRCUWXFGSA-N |
| XLogP | 3.24 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|