C20H22N2O3S — CID 7153408
N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-2-phenoxyacetamide (PubChem CID 7153408) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-2-phenoxyacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 7153408 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-2-phenoxyacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)COc2ccccc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C20H22N2O3S/c1-3-24-13-12-22-19-15(2)8-7-11-17(19)26-20(22)21-18(23)14-25-16-9-5-4-6-10-16/h4-11H,3,12-14H2,1-2H3/b21-20- |
| InChIKey | WVGAXHYWAQTVER-MRCUWXFGSA-N |
| XLogP | 3.55 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|