C16H11FN2OS2 — CID 41340062
N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide (PubChem CID 41340062) has the molecular formula C16H11FN2OS2 and a molecular weight of 330.41 g/mol. Its IUPAC name is N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide.
| Compound Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 41340062 |
| Molecular Formula | C16H11FN2OS2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-(6-fluoro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2-thiophen-2-ylacetamide |
| SMILES | C#CCn1/c(=N/C(=O)Cc2cccs2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C16H11FN2OS2/c1-2-7-19-13-6-5-11(17)9-14(13)22-16(19)18-15(20)10-12-4-3-8-21-12/h1,3-6,8-9H,7,10H2/b18-16- |
| InChIKey | DADMAWRGWFGNBY-VLGSPTGOSA-N |
| XLogP | 3.21 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|