C19H17N3O5S3 — CID 16822968
3-ethylsulfonyl-N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 16822968) has the molecular formula C19H17N3O5S3 and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-ethylsulfonyl-N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 16822968 |
| Molecular Formula | C19H17N3O5S3 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 3-ethylsulfonyl-N-(3-prop-2-ynyl-6-sulfamoyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(S(=O)(=O)CC)c2)sc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H17N3O5S3/c1-3-10-22-16-9-8-15(30(20,26)27)12-17(16)28-19(22)21-18(23)13-6-5-7-14(11-13)29(24,25)4-2/h1,5-9,11-12H,4,10H2,2H3,(H2,20,26,27)/b21-19- |
| InChIKey | MZCHTUOOKDLNAT-VZCXRCSSSA-N |
| XLogP | 1.52 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|