C18H18N2O3S2 — CID 7553173
N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide (PubChem CID 7553173) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide.
| Compound Name | N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 7553173 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-3-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)/N=c2\sc3cc(C)ccc3n2C)c1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-4-25(22,23)14-7-5-6-13(11-14)17(21)19-18-20(3)15-9-8-12(2)10-16(15)24-18/h5-11H,4H2,1-3H3/b19-18- |
| InChIKey | INKWLSGIJOVJDZ-HNENSFHCSA-N |
| XLogP | 3.08 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |