C21H18N2O3S2 — CID 40697546
3-ethylsulfonyl-N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)benzamide (PubChem CID 40697546) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-ethylsulfonyl-N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40697546 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3-ethylsulfonyl-N-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)benzamide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)/N=c2\sc3ccc4ccccc4c3n2C)c1 |
| InChI | InChI=1S/C21H18N2O3S2/c1-3-28(25,26)16-9-6-8-15(13-16)20(24)22-21-23(2)19-17-10-5-4-7-14(17)11-12-18(19)27-21/h4-13H,3H2,1-2H3/b22-21- |
| InChIKey | UXWQFIZZHOGLIJ-DQRAZIAOSA-N |
| XLogP | 3.93 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |