C18H19ClN2O5S3 — CID 40892560
ethyl 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 40892560) has the molecular formula C18H19ClN2O5S3 and a molecular weight of 475.01 g/mol. Its IUPAC name is ethyl 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40892560 |
| Molecular Formula | C18H19ClN2O5S3 |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | ethyl 2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C18H19ClN2O5S3/c1-3-25-10-9-21-13-6-5-12(17(22)26-4-2)11-14(13)27-18(21)20-29(23,24)16-8-7-15(19)28-16/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | JSEODKVOWMYQRN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|