C17H18ClN3O4S3 — CID 40892568
N-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 40892568) has the molecular formula C17H18ClN3O4S3 and a molecular weight of 460.00 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 40892568 |
| Molecular Formula | C17H18ClN3O4S3 |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-(2-ethoxyethyl)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C17H18ClN3O4S3/c1-3-25-9-8-21-13-5-4-12(19-11(2)22)10-14(13)26-17(21)20-28(23,24)16-7-6-15(18)27-16/h4-7,10H,3,8-9H2,1-2H3,(H,19,22) |
| InChIKey | PGUAUKJFEDEVLX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|