C22H20N2O2S — CID 4577895
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]naphthalene-1-carboxamide (PubChem CID 4577895) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]naphthalene-1-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4577895 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]naphthalene-1-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cccc3ccccc23)sc2ccccc21 |
| InChI | InChI=1S/C22H20N2O2S/c1-2-26-15-14-24-19-12-5-6-13-20(19)27-22(24)23-21(25)18-11-7-9-16-8-3-4-10-17(16)18/h3-13H,2,14-15H2,1H3/b23-22- |
| InChIKey | AZJTYBWEWGHOAK-FCQUAONHSA-N |
| XLogP | 4.63 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|