C20H22N2O4S — CID 5100755
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide (PubChem CID 5100755) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 5100755 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-3,5-dimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(OC)cc(OC)c2)sc2ccccc21 |
| InChI | InChI=1S/C20H22N2O4S/c1-4-26-10-9-22-17-7-5-6-8-18(17)27-20(22)21-19(23)14-11-15(24-2)13-16(12-14)25-3/h5-8,11-13H,4,9-10H2,1-3H3/b21-20- |
| InChIKey | MQHNOAOENCMXNG-MRCUWXFGSA-N |
| XLogP | 3.50 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|