C17H16N2O2S — CID 4064574
N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzamide (PubChem CID 4064574) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzamide.
| Compound Name | N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzamide |
|---|---|
| PubChem CID | 4064574 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzamide |
| SMILES | CCn1/c(=N/C(=O)c2ccc(OC)cc2)sc2ccccc21 |
| InChI | InChI=1S/C17H16N2O2S/c1-3-19-14-6-4-5-7-15(14)22-17(19)18-16(20)12-8-10-13(21-2)11-9-12/h4-11H,3H2,1-2H3/b18-17- |
| InChIKey | OHMNCRAYWDRIHW-ZCXUNETKSA-N |
| XLogP | 3.47 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |