C16H14Cl2N2O2S2 — CID 4103243
2,5-dichloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-3-carboxamide (PubChem CID 4103243) has the molecular formula C16H14Cl2N2O2S2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4103243 |
| Molecular Formula | C16H14Cl2N2O2S2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 2,5-dichloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-3-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc(Cl)sc2Cl)sc2ccccc21 |
| InChI | InChI=1S/C16H14Cl2N2O2S2/c1-2-22-8-7-20-11-5-3-4-6-12(11)23-16(20)19-15(21)10-9-13(17)24-14(10)18/h3-6,9H,2,7-8H2,1H3/b19-16- |
| InChIKey | WAQICIHKBIWKPK-MNDPQUGUSA-N |
| XLogP | 4.85 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|