C22H22N4O2S — CID 43938175
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 43938175) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43938175 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cnn(-c3ccccc3)c2C)sc2ccccc21 |
| InChI | InChI=1S/C22H22N4O2S/c1-3-28-14-13-25-19-11-7-8-12-20(19)29-22(25)24-21(27)18-15-23-26(16(18)2)17-9-5-4-6-10-17/h4-12,15H,3,13-14H2,1-2H3/b24-22- |
| InChIKey | LBEIOVOUAYLESP-GYHWCHFESA-N |
| XLogP | 3.97 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|