C23H19ClN2O2S — CID 43944618
N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide (PubChem CID 43944618) has the molecular formula C23H19ClN2O2S and a molecular weight of 422.94 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 43944618 |
| Molecular Formula | C23H19ClN2O2S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-methoxynaphthalene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc3ccccc3cc2OC)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C23H19ClN2O2S/c1-4-11-26-21-14(2)18(24)9-10-20(21)29-23(26)25-22(27)17-12-15-7-5-6-8-16(15)13-19(17)28-3/h4-10,12-13H,1,11H2,2-3H3/b25-23- |
| InChIKey | MEZNLVJPBCKFGI-BZZOAKBMSA-N |
| XLogP | 5.75 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|