C24H19ClN2O2S — CID 43944608
N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide (PubChem CID 43944608) has the molecular formula C24H19ClN2O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide.
| Compound Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 43944608 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccccc2Oc2ccccc2)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C24H19ClN2O2S/c1-3-15-27-22-16(2)19(25)13-14-21(22)30-24(27)26-23(28)18-11-7-8-12-20(18)29-17-9-5-4-6-10-17/h3-14H,1,15H2,2H3/b26-24- |
| InChIKey | PEVQGFLXECHYOA-LCUIJRPUSA-N |
| XLogP | 6.38 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|