C23H16Cl2N2O2S — CID 43944611
N-(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide (PubChem CID 43944611) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is N-(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide.
| Compound Name | N-(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 43944611 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N-(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccccc2Oc2ccccc2)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C23H16Cl2N2O2S/c1-2-14-27-21-19(13-12-17(24)20(21)25)30-23(27)26-22(28)16-10-6-7-11-18(16)29-15-8-4-3-5-9-15/h2-13H,1,14H2/b26-23- |
| InChIKey | FHZYUMCDIFFWBO-RWEWTDSWSA-N |
| XLogP | 6.73 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|