C22H17ClN2O2S — CID 4192621
N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide (PubChem CID 4192621) has the molecular formula C22H17ClN2O2S and a molecular weight of 408.91 g/mol. Its IUPAC name is N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide.
| Compound Name | N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
|---|---|
| PubChem CID | 4192621 |
| Molecular Formula | C22H17ClN2O2S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(4-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-2-phenoxybenzamide |
| SMILES | CCn1/c(=N/C(=O)c2ccccc2Oc2ccccc2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C22H17ClN2O2S/c1-2-25-20-17(23)12-8-14-19(20)28-22(25)24-21(26)16-11-6-7-13-18(16)27-15-9-4-3-5-10-15/h3-14H,2H2,1H3/b24-22- |
| InChIKey | BKSHLFOZOWJBFX-GYHWCHFESA-N |
| XLogP | 5.91 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |