C24H27ClN2O4S — CID 43944491
N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3,4,5-triethoxybenzamide (PubChem CID 43944491) has the molecular formula C24H27ClN2O4S and a molecular weight of 475.01 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3,4,5-triethoxybenzamide.
| Compound Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 43944491 |
| Molecular Formula | C24H27ClN2O4S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3,4,5-triethoxybenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(OCC)c(OCC)c(OCC)c2)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C24H27ClN2O4S/c1-6-12-27-21-15(5)17(25)10-11-20(21)32-24(27)26-23(28)16-13-18(29-7-2)22(31-9-4)19(14-16)30-8-3/h6,10-11,13-14H,1,7-9,12H2,2-5H3/b26-24- |
| InChIKey | DARURTNSKFROKE-LCUIJRPUSA-N |
| XLogP | 5.79 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|