C18H14BrClN2OS — CID 43943712
3-bromo-N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43943712) has the molecular formula C18H14BrClN2OS and a molecular weight of 421.75 g/mol. Its IUPAC name is 3-bromo-N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-bromo-N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43943712 |
| Molecular Formula | C18H14BrClN2OS |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 3-bromo-N-(5-chloro-4-methyl-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cccc(Br)c2)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C18H14BrClN2OS/c1-3-9-22-16-11(2)14(20)7-8-15(16)24-18(22)21-17(23)12-5-4-6-13(19)10-12/h3-8,10H,1,9H2,2H3/b21-18- |
| InChIKey | CCQWCDBLPMQHNF-UZYVYHOESA-N |
| XLogP | 5.35 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|