C21H21N3O6S — CID 43942954
N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43942954) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43942954 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C21H21N3O6S/c1-5-9-23-15-8-7-13(30-6-2)10-19(15)31-21(23)22-20(25)14-11-17(28-3)18(29-4)12-16(14)24(26)27/h5,7-8,10-12H,1,6,9H2,2-4H3/b22-21- |
| InChIKey | WPTBZUFLWQSMAY-DQRAZIAOSA-N |
| XLogP | 3.95 |
| TPSA | 105.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|