C23H24N4O5S — CID 43943439
N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43943439) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43943439 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-(6-ethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C23H24N4O5S/c1-3-9-26-19-8-6-17(32-4-2)15-21(19)33-23(26)24-22(28)16-5-7-18(20(14-16)27(29)30)25-10-12-31-13-11-25/h3,5-8,14-15H,1,4,9-13H2,2H3/b24-23- |
| InChIKey | ROLPABKHAYFXRJ-VHXPQNKSSA-N |
| XLogP | 3.77 |
| TPSA | 99.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|