C22H24N4O5S — CID 43938185
N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43938185) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43938185 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)sc2ccccc21 |
| InChI | InChI=1S/C22H24N4O5S/c1-2-30-14-11-25-18-5-3-4-6-20(18)32-22(25)23-21(27)16-7-8-17(19(15-16)26(28)29)24-9-12-31-13-10-24/h3-8,15H,2,9-14H2,1H3/b23-22- |
| InChIKey | MZKKAQAXGPEUBW-FCQUAONHSA-N |
| XLogP | 3.23 |
| TPSA | 99.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|