C24H24N4O7S — CID 43940929
methyl 3-(2-methoxy-2-oxoethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43940929) has the molecular formula C24H24N4O7S and a molecular weight of 512.54 g/mol. Its IUPAC name is methyl 3-(2-methoxy-2-oxoethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-methoxy-2-oxoethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43940929 |
| Molecular Formula | C24H24N4O7S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | methyl 3-(2-methoxy-2-oxoethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C24H24N4O7S/c1-34-21(29)14-27-18-9-7-16(23(31)35-2)13-20(18)36-24(27)25-22(30)15-6-8-17(19(12-15)28(32)33)26-10-4-3-5-11-26/h6-9,12-13H,3-5,10-11,14H2,1-2H3/b25-24- |
| InChIKey | IAGMVKOTBIKRJN-IZHYLOQSSA-N |
| XLogP | 3.30 |
| TPSA | 133.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|