C26H30N4O5S — CID 43941390
methyl 2-[6-butyl-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941390) has the molecular formula C26H30N4O5S and a molecular weight of 510.62 g/mol. Its IUPAC name is methyl 2-[6-butyl-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[6-butyl-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941390 |
| Molecular Formula | C26H30N4O5S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | methyl 2-[6-butyl-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCCCc1ccc2c(c1)s/c(=N\C(=O)c1ccc(N3CCCCC3)c([N+](=O)[O-])c1)n2CC(=O)OC |
| InChI | InChI=1S/C26H30N4O5S/c1-3-4-8-18-9-11-21-23(15-18)36-26(29(21)17-24(31)35-2)27-25(32)19-10-12-20(22(16-19)30(33)34)28-13-6-5-7-14-28/h9-12,15-16H,3-8,13-14,17H2,1-2H3/b27-26- |
| InChIKey | WGDNIZCRVRHCOF-RQZHXJHFSA-N |
| XLogP | 4.86 |
| TPSA | 107.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|