C24H26N4O6S — CID 43938427
methyl 3-(2-methoxyethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43938427) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is methyl 3-(2-methoxyethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-methoxyethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43938427 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | methyl 3-(2-methoxyethyl)-2-(3-nitro-4-piperidin-1-ylbenzoyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | COCCn1/c(=N/C(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C24H26N4O6S/c1-33-13-12-27-19-9-7-17(23(30)34-2)15-21(19)35-24(27)25-22(29)16-6-8-18(20(14-16)28(31)32)26-10-4-3-5-11-26/h6-9,14-15H,3-5,10-13H2,1-2H3/b25-24- |
| InChIKey | ZREWSOLAKPLGAZ-IZHYLOQSSA-N |
| XLogP | 3.78 |
| TPSA | 116.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|