C20H18N2OS — CID 40886274
2,5-dimethyl-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 40886274) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 2,5-dimethyl-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 40886274 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2,5-dimethyl-N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(C)ccc2C)sc2cccc(C)c21 |
| InChI | InChI=1S/C20H18N2OS/c1-5-11-22-18-15(4)7-6-8-17(18)24-20(22)21-19(23)16-12-13(2)9-10-14(16)3/h1,6-10,12H,11H2,2-4H3/b21-20- |
| InChIKey | XSBKQLSXZZDDTL-MRCUWXFGSA-N |
| XLogP | 4.00 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|