C23H24N2O2S — CID 43946319
N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide (PubChem CID 43946319) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide.
| Compound Name | N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 43946319 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(4-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(OCCCCC)cc2)sc2cccc(C)c21 |
| InChI | InChI=1S/C23H24N2O2S/c1-4-6-7-16-27-19-13-11-18(12-14-19)22(26)24-23-25(15-5-2)21-17(3)9-8-10-20(21)28-23/h2,8-14H,4,6-7,15-16H2,1,3H3/b24-23- |
| InChIKey | PQOIGIZPYODIKO-VHXPQNKSSA-N |
| XLogP | 4.95 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|