C17H10Cl3N3O5S — CID 41204933
methyl 2-[4,5-dichloro-2-(5-chloro-2-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 41204933) has the molecular formula C17H10Cl3N3O5S and a molecular weight of 474.71 g/mol. Its IUPAC name is methyl 2-[4,5-dichloro-2-(5-chloro-2-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4,5-dichloro-2-(5-chloro-2-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204933 |
| Molecular Formula | C17H10Cl3N3O5S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | methyl 2-[4,5-dichloro-2-(5-chloro-2-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C17H10Cl3N3O5S/c1-28-13(24)7-22-15-12(5-3-10(19)14(15)20)29-17(22)21-16(25)9-6-8(18)2-4-11(9)23(26)27/h2-6H,7H2,1H3/b21-17- |
| InChIKey | XEUNJLIJBZPVBE-FXBPSFAMSA-N |
| XLogP | 4.49 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|