C19H16ClN3O5S — CID 4997257
ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 4997257) has the molecular formula C19H16ClN3O5S and a molecular weight of 433.87 g/mol. Its IUPAC name is ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4997257 |
| Molecular Formula | C19H16ClN3O5S |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | ethyl 2-[2-(5-chloro-2-nitrobenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc(Cl)ccc2[N+](=O)[O-])sc2cc(C)ccc21 |
| InChI | InChI=1S/C19H16ClN3O5S/c1-3-28-17(24)10-22-15-6-4-11(2)8-16(15)29-19(22)21-18(25)13-9-12(20)5-7-14(13)23(26)27/h4-9H,3,10H2,1-2H3/b21-19- |
| InChIKey | NSLQDZCSGBTGTQ-VZCXRCSSSA-N |
| XLogP | 3.88 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|