C17H14N4O6S2 — CID 4127513
methyl 2-[6-acetamido-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4127513) has the molecular formula C17H14N4O6S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is methyl 2-[6-acetamido-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[6-acetamido-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4127513 |
| Molecular Formula | C17H14N4O6S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | methyl 2-[6-acetamido-2-(5-nitrothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C17H14N4O6S2/c1-9(22)18-10-3-4-11-13(7-10)29-17(20(11)8-15(23)27-2)19-16(24)12-5-6-14(28-12)21(25)26/h3-7H,8H2,1-2H3,(H,18,22)/b19-17- |
| InChIKey | BHIWGAUBEHBWQL-ZPHPHTNESA-N |
| XLogP | 2.55 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|