C15H13N3O3S2 — CID 4123845
N-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide (PubChem CID 4123845) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4123845 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-(3-ethyl-6-methyl-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C15H13N3O3S2/c1-3-17-10-5-4-9(2)8-12(10)23-15(17)16-14(19)11-6-7-13(22-11)18(20)21/h4-8H,3H2,1-2H3/b16-15- |
| InChIKey | GHKMIXAPJGIEAM-NXVVXOECSA-N |
| XLogP | 3.74 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|