C16H15N3O5S4 — CID 41125516
N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide (PubChem CID 41125516) has the molecular formula C16H15N3O5S4 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41125516 |
| Molecular Formula | C16H15N3O5S4 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]-5-nitrothiophene-2-carboxamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C16H15N3O5S4/c1-25-8-7-18-11-4-3-10(28(2,23)24)9-13(11)27-16(18)17-15(20)12-5-6-14(26-12)19(21)22/h3-6,9H,7-8H2,1-2H3/b17-16- |
| InChIKey | VQFJFNGHCZVCAF-MSUUIHNZSA-N |
| XLogP | 3.18 |
| TPSA | 111.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|