C14H10FN3O3S2 — CID 5090047
N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide (PubChem CID 5090047) has the molecular formula C14H10FN3O3S2 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5090047 |
| Molecular Formula | C14H10FN3O3S2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-(3-ethyl-4-fluoro-1,3-benzothiazol-2-ylidene)-5-nitrothiophene-2-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])s2)sc2cccc(F)c21 |
| InChI | InChI=1S/C14H10FN3O3S2/c1-2-17-12-8(15)4-3-5-9(12)23-14(17)16-13(19)10-6-7-11(22-10)18(20)21/h3-7H,2H2,1H3/b16-14- |
| InChIKey | ZMNBFYVXBVISTP-PEZBUJJGSA-N |
| XLogP | 3.57 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|