C16H11F2N3O3S — CID 2151038
N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide (PubChem CID 2151038) has the molecular formula C16H11F2N3O3S and a molecular weight of 363.35 g/mol. Its IUPAC name is N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide.
| Compound Name | N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
|---|---|
| PubChem CID | 2151038 |
| Molecular Formula | C16H11F2N3O3S |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
| SMILES | CCn1/c(=N/C(=O)c2cccc([N+](=O)[O-])c2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C16H11F2N3O3S/c1-2-20-14-12(18)7-10(17)8-13(14)25-16(20)19-15(22)9-4-3-5-11(6-9)21(23)24/h3-8H,2H2,1H3/b19-16- |
| InChIKey | KSMKXXSULAOKQH-MNDPQUGUSA-N |
| XLogP | 3.65 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|