C15H10FN3O3S — CID 4183334
N-(6-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide (PubChem CID 4183334) has the molecular formula C15H10FN3O3S and a molecular weight of 331.33 g/mol. Its IUPAC name is N-(6-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide.
| Compound Name | N-(6-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4183334 |
| Molecular Formula | C15H10FN3O3S |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(6-fluoro-3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
| SMILES | Cn1/c(=N/C(=O)c2cccc([N+](=O)[O-])c2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C15H10FN3O3S/c1-18-12-6-5-10(16)8-13(12)23-15(18)17-14(20)9-3-2-4-11(7-9)19(21)22/h2-8H,1H3/b17-15- |
| InChIKey | ZFPXAMYDCZRTCG-ICFOKQHNSA-N |
| XLogP | 3.03 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|