C16H12FN3O3S — CID 42524726
2-(4-fluorophenyl)-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 42524726) has the molecular formula C16H12FN3O3S and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 42524726 |
| Molecular Formula | C16H12FN3O3S |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(3-methyl-6-nitro-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | Cn1/c(=N/C(=O)Cc2ccc(F)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H12FN3O3S/c1-19-13-7-6-12(20(22)23)9-14(13)24-16(19)18-15(21)8-10-2-4-11(17)5-3-10/h2-7,9H,8H2,1H3/b18-16- |
| InChIKey | FULAXGMNTNVTTM-VLGSPTGOSA-N |
| XLogP | 2.96 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|