C16H12FN3O3S2 — CID 16850727
2-(4-fluorophenyl)sulfanyl-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 16850727) has the molecular formula C16H12FN3O3S2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 16850727 |
| Molecular Formula | C16H12FN3O3S2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | Cn1/c(=N/C(=O)CSc2ccc(F)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H12FN3O3S2/c1-19-13-8-11(20(22)23)4-7-14(13)25-16(19)18-15(21)9-24-12-5-2-10(17)3-6-12/h2-8H,9H2,1H3/b18-16- |
| InChIKey | JWQJXQHYWTYCOE-VLGSPTGOSA-N |
| XLogP | 3.51 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|