C16H13N3O3S2 — CID 16850744
N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-methylsulfanylbenzamide (PubChem CID 16850744) has the molecular formula C16H13N3O3S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-methylsulfanylbenzamide.
| Compound Name | N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 16850744 |
| Molecular Formula | C16H13N3O3S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)/N=c2\sc3ccc([N+](=O)[O-])cc3n2C)cc1 |
| InChI | InChI=1S/C16H13N3O3S2/c1-18-13-9-11(19(21)22)5-8-14(13)24-16(18)17-15(20)10-3-6-12(23-2)7-4-10/h3-9H,1-2H3/b17-16- |
| InChIKey | JGRGJUCZTKBFJG-MSUUIHNZSA-N |
| XLogP | 3.61 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|