C15H11N3O3S — CID 8696411
N-(3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide (PubChem CID 8696411) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-(3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide.
| Compound Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
|---|---|
| PubChem CID | 8696411 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
| SMILES | Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2ccccc21 |
| InChI | InChI=1S/C15H11N3O3S/c1-17-12-4-2-3-5-13(12)22-15(17)16-14(19)10-6-8-11(9-7-10)18(20)21/h2-9H,1H3/b16-15- |
| InChIKey | BCCMEYACPJDHTD-NXVVXOECSA-N |
| XLogP | 2.89 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|