C16H14N4O3S — CID 7892459
4-(methylamino)-N-(3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide (PubChem CID 7892459) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-(methylamino)-N-(3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide.
| Compound Name | 4-(methylamino)-N-(3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
|---|---|
| PubChem CID | 7892459 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(methylamino)-N-(3-methyl-1,3-benzothiazol-2-ylidene)-3-nitrobenzamide |
| SMILES | CNc1ccc(C(=O)/N=c2\sc3ccccc3n2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O3S/c1-17-11-8-7-10(9-13(11)20(22)23)15(21)18-16-19(2)12-5-3-4-6-14(12)24-16/h3-9,17H,1-2H3/b18-16- |
| InChIKey | OJWAHMAEHCCJML-VLGSPTGOSA-N |
| XLogP | 2.93 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|