C16H14N2OS — CID 2330376
4-methyl-N-(3-methyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 2330376) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-methyl-N-(3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 2330376 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-methyl-N-(3-methyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | Cc1ccc(C(=O)/N=c2\sc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C16H14N2OS/c1-11-7-9-12(10-8-11)15(19)17-16-18(2)13-5-3-4-6-14(13)20-16/h3-10H,1-2H3/b17-16- |
| InChIKey | GZVAASYAAGZEDR-MSUUIHNZSA-N |
| XLogP | 3.29 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |