C20H20N2OS — CID 142713314
N-(3-cyclopentyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide (PubChem CID 142713314) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(3-cyclopentyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide.
| Compound Name | N-(3-cyclopentyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide |
|---|---|
| PubChem CID | 142713314 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(3-cyclopentyl-1,3-benzothiazol-2-ylidene)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)/N=c2\sc3ccccc3n2C2CCCC2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-14-10-12-15(13-11-14)19(23)21-20-22(16-6-2-3-7-16)17-8-4-5-9-18(17)24-20/h4-5,8-13,16H,2-3,6-7H2,1H3/b21-20- |
| InChIKey | VCGOAGYSKXNQLK-MRCUWXFGSA-N |
| XLogP | 4.87 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |