C18H16N2O3S — CID 142713499
[2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]methyl acetate (PubChem CID 142713499) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]methyl acetate.
| Compound Name | [2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 142713499 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]methyl acetate |
| SMILES | CC(=O)OCn1/c(=N/C(=O)c2ccc(C)cc2)sc2ccccc21 |
| InChI | InChI=1S/C18H16N2O3S/c1-12-7-9-14(10-8-12)17(22)19-18-20(11-23-13(2)21)15-5-3-4-6-16(15)24-18/h3-10H,11H2,1-2H3/b19-18- |
| InChIKey | RXCAQORFTNLYSQ-HNENSFHCSA-N |
| XLogP | 3.27 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |