C21H22N2O3S — CID 142713325
6-[2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 142713325) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 6-[2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 142713325 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-[2-(4-methylbenzoyl)imino-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | Cc1ccc(C(=O)/N=c2\sc3ccccc3n2CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-15-10-12-16(13-11-15)20(26)22-21-23(14-6-2-3-9-19(24)25)17-7-4-5-8-18(17)27-21/h4-5,7-8,10-13H,2-3,6,9,14H2,1H3,(H,24,25)/b22-21- |
| InChIKey | WRNATJSWIJVOTI-DQRAZIAOSA-N |
| XLogP | 4.40 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|