C16H10N4O3S — CID 16850647
4-cyano-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 16850647) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 4-cyano-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-cyano-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 16850647 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-cyano-N-(3-methyl-5-nitro-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | Cn1/c(=N/C(=O)c2ccc(C#N)cc2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H10N4O3S/c1-19-13-8-12(20(22)23)6-7-14(13)24-16(19)18-15(21)11-4-2-10(9-17)3-5-11/h2-8H,1H3/b18-16- |
| InChIKey | WVTVFVUBZJRRHS-VLGSPTGOSA-N |
| XLogP | 2.76 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|