C15H9F2N3O3S — CID 2151033
N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide (PubChem CID 2151033) has the molecular formula C15H9F2N3O3S and a molecular weight of 349.32 g/mol. Its IUPAC name is N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide.
| Compound Name | N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
|---|---|
| PubChem CID | 2151033 |
| Molecular Formula | C15H9F2N3O3S |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-4-nitrobenzamide |
| SMILES | Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C15H9F2N3O3S/c1-19-13-11(17)6-9(16)7-12(13)24-15(19)18-14(21)8-2-4-10(5-3-8)20(22)23/h2-7H,1H3/b18-15- |
| InChIKey | SNHUBTNFQAIBJT-SDXDJHTJSA-N |
| XLogP | 3.17 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|